C9H20FN — CID 142151955
ethane;3-(fluoromethyl)-1,4-dimethylpyrrolidine (PubChem CID 142151955) has the molecular formula C9H20FN and a molecular weight of 161.26 g/mol. Its IUPAC name is ethane;3-(fluoromethyl)-1,4-dimethylpyrrolidine.
| Compound Name | ethane;3-(fluoromethyl)-1,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 142151955 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | ethane;3-(fluoromethyl)-1,4-dimethylpyrrolidine |
| SMILES | CC.CC1CN(C)CC1CF |
| InChI | InChI=1S/C7H14FN.C2H6/c1-6-4-9(2)5-7(6)3-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | IUIUOGWKQOMFLD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |