C9H19N — CID 59081993
1,3,4-trimethylazepane (PubChem CID 59081993) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,3,4-trimethylazepane.
| Compound Name | 1,3,4-trimethylazepane |
|---|---|
| PubChem CID | 59081993 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,3,4-trimethylazepane |
| SMILES | CC1CCCN(C)CC1C |
| InChI | InChI=1S/C9H19N/c1-8-5-4-6-10(3)7-9(8)2/h8-9H,4-7H2,1-3H3 |
| InChIKey | GYBJWWMJHBTJPQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |