C8H16V — CID 142004480
1,2-dimethylcyclohexane;vanadium (PubChem CID 142004480) has the molecular formula C8H16V and a molecular weight of 163.16 g/mol. Its IUPAC name is 1,2-dimethylcyclohexane;vanadium.
| Compound Name | 1,2-dimethylcyclohexane;vanadium |
|---|---|
| PubChem CID | 142004480 |
| Molecular Formula | C8H16V |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1,2-dimethylcyclohexane;vanadium |
| SMILES | CC1CCCCC1C.[V] |
| InChI | InChI=1S/C8H16.V/c1-7-5-3-4-6-8(7)2;/h7-8H,3-6H2,1-2H3; |
| InChIKey | XTAZFIJMJYPMMO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |