C21H42 — CID 123549851
1,2-dimethylcyclononadecane (PubChem CID 123549851) has the molecular formula C21H42 and a molecular weight of 294.57 g/mol. Its IUPAC name is 1,2-dimethylcyclononadecane.
| Compound Name | 1,2-dimethylcyclononadecane |
|---|---|
| PubChem CID | 123549851 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 1,2-dimethylcyclononadecane |
| SMILES | CC1CCCCCCCCCCCCCCCCCC1C |
| InChI | InChI=1S/C21H42/c1-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21(20)2/h20-21H,3-19H2,1-2H3 |
| InChIKey | XMSRGFOOVBDZAO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |