C9H21N — CID 142167756
cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine (PubChem CID 142167756) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine.
| Compound Name | cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine |
|---|---|
| PubChem CID | 142167756 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine |
| SMILES | CN.C[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C8H16.CH5N/c1-7-5-3-4-6-8(7)2;1-2/h7-8H,3-6H2,1-2H3;2H2,1H3/t7-,8+; |
| InChIKey | HUSAXBHIIXJTSP-KVZVIFLMSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |