About cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine
cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine (PubChem CID 142167756) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine.
Molecular Properties
| Compound Name | cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine |
| PubChem CID | 142167756 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine |
| SMILES | CN.C[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C8H16.CH5N/c1-7-5-3-4-6-8(7)2;1-2/h7-8H,3-6H2,1-2H3;2H2,1H3/t7-,8+; |
| InChIKey | HUSAXBHIIXJTSP-KVZVIFLMSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine?
The IUPAC name of cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine (CID 142167756) is cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine.
What is the SMILES notation for cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine?
The canonical SMILES for cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine is CN.C[C@@H]1CCCC[C@@H]1C.
What is the InChIKey of cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine?
The InChIKey is HUSAXBHIIXJTSP-KVZVIFLMSA-N. The full InChI is InChI=1S/C8H16.CH5N/c1-7-5-3-4-6-8(7)2;1-2/h7-8H,3-6H2,1-2H3;2H2,1H3/t7-,8+;.
What are the key properties of cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine?
cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine has a molecular weight of 143.27 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-1,2-dimethylcyclohexane;methanamine is sourced from PubChem (CID 142167756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).