C10H21N — CID 83905212
(2,7-dimethylcycloheptyl)methanamine (PubChem CID 83905212) has the molecular formula C10H21N and a molecular weight of 155.29 g/mol. Its IUPAC name is (2,7-dimethylcycloheptyl)methanamine.
| Compound Name | (2,7-dimethylcycloheptyl)methanamine |
|---|---|
| PubChem CID | 83905212 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.29 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (2,7-dimethylcycloheptyl)methanamine |
| SMILES | CC1CCCCC(C)C1CN |
| InChI | InChI=1S/C10H21N/c1-8-5-3-4-6-9(2)10(8)7-11/h8-10H,3-7,11H2,1-2H3 |
| InChIKey | AHVYMAPFZUCLSU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |