C13H30 — CID 142115318
1,2-dimethylcyclohexane;ethane;propane (PubChem CID 142115318) has the molecular formula C13H30 and a molecular weight of 186.38 g/mol. Its IUPAC name is 1,2-dimethylcyclohexane;ethane;propane.
| Compound Name | 1,2-dimethylcyclohexane;ethane;propane |
|---|---|
| PubChem CID | 142115318 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 1,2-dimethylcyclohexane;ethane;propane |
| SMILES | CC.CC1CCCCC1C.CCC |
| InChI | InChI=1S/C8H16.C3H8.C2H6/c1-7-5-3-4-6-8(7)2;1-3-2;1-2/h7-8H,3-6H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | RQVUXHHJZMQGQJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |