C9H20 — CID 91129712
ethane;trans-(1R,2R)-1,2-dimethylcyclopentane (PubChem CID 91129712) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is ethane;trans-(1R,2R)-1,2-dimethylcyclopentane.
| Compound Name | ethane;trans-(1R,2R)-1,2-dimethylcyclopentane |
|---|---|
| PubChem CID | 91129712 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | ethane;trans-(1R,2R)-1,2-dimethylcyclopentane |
| SMILES | CC.C[C@@H]1CCC[C@H]1C |
| InChI | InChI=1S/C7H14.C2H6/c1-6-4-3-5-7(6)2;1-2/h6-7H,3-5H2,1-2H3;1-2H3/t6-,7-;/m1./s1 |
| InChIKey | ODNTXLORTJSYMR-ZJLYAJKPSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |