About dichlorotitanium;1,2-dimethylcyclopentane
dichlorotitanium;1,2-dimethylcyclopentane (PubChem CID 174468926) has the molecular formula C7H14Cl2Ti
and a molecular weight of 216.96 g/mol. Its IUPAC name is dichlorotitanium;1,2-dimethylcyclopentane.
Molecular Properties
| Compound Name | dichlorotitanium;1,2-dimethylcyclopentane |
| PubChem CID | 174468926 |
| Molecular Formula | C7H14Cl2Ti |
| Molecular Weight | 216.96 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | dichlorotitanium;1,2-dimethylcyclopentane |
| SMILES | CC1CCCC1C.Cl[Ti]Cl |
| InChI | InChI=1S/C7H14.2ClH.Ti/c1-6-4-3-5-7(6)2;;;/h6-7H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YGVNURFKGCCGCR-UHFFFAOYSA-L |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorotitanium;1,2-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;1,2-dimethylcyclopentane?
The IUPAC name of dichlorotitanium;1,2-dimethylcyclopentane (CID 174468926) is dichlorotitanium;1,2-dimethylcyclopentane.
What is the SMILES notation for dichlorotitanium;1,2-dimethylcyclopentane?
The canonical SMILES for dichlorotitanium;1,2-dimethylcyclopentane is CC1CCCC1C.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;1,2-dimethylcyclopentane?
The InChIKey is YGVNURFKGCCGCR-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H14.2ClH.Ti/c1-6-4-3-5-7(6)2;;;/h6-7H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;1,2-dimethylcyclopentane?
dichlorotitanium;1,2-dimethylcyclopentane has a molecular weight of 216.96 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;1,2-dimethylcyclopentane is sourced from PubChem (CID 174468926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).