C7H14Cl2Ti — CID 174468926
dichlorotitanium;1,2-dimethylcyclopentane (PubChem CID 174468926) has the molecular formula C7H14Cl2Ti and a molecular weight of 216.96 g/mol. Its IUPAC name is dichlorotitanium;1,2-dimethylcyclopentane.
| Compound Name | dichlorotitanium;1,2-dimethylcyclopentane |
|---|---|
| PubChem CID | 174468926 |
| Molecular Formula | C7H14Cl2Ti |
| Molecular Weight | 216.96 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | dichlorotitanium;1,2-dimethylcyclopentane |
| SMILES | CC1CCCC1C.Cl[Ti]Cl |
| InChI | InChI=1S/C7H14.2ClH.Ti/c1-6-4-3-5-7(6)2;;;/h6-7H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YGVNURFKGCCGCR-UHFFFAOYSA-L |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |