C22H44 — CID 123296856
1,2-dimethylcycloicosane (PubChem CID 123296856) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is 1,2-dimethylcycloicosane.
| Compound Name | 1,2-dimethylcycloicosane |
|---|---|
| PubChem CID | 123296856 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | 1,2-dimethylcycloicosane |
| SMILES | CC1CCCCCCCCCCCCCCCCCCC1C |
| InChI | InChI=1S/C22H44/c1-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22(21)2/h21-22H,3-20H2,1-2H3 |
| InChIKey | JIMFOZLQLKJIOS-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |