About 1,2,3-trimethylcycloheptane
1,2,3-trimethylcycloheptane (PubChem CID 54005509) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is 1,2,3-trimethylcycloheptane.
Molecular Properties
| Compound Name | 1,2,3-trimethylcycloheptane |
| PubChem CID | 54005509 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 1,2,3-trimethylcycloheptane |
| SMILES | CC1CCCCC(C)C1C |
| InChI | InChI=1S/C10H20/c1-8-6-4-5-7-9(2)10(8)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | AOAOTQWOPAKPEL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,3-trimethylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethylcycloheptane?
The IUPAC name of 1,2,3-trimethylcycloheptane (CID 54005509) is 1,2,3-trimethylcycloheptane.
What is the SMILES notation for 1,2,3-trimethylcycloheptane?
The canonical SMILES for 1,2,3-trimethylcycloheptane is CC1CCCCC(C)C1C.
What is the InChIKey of 1,2,3-trimethylcycloheptane?
The InChIKey is AOAOTQWOPAKPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-8-6-4-5-7-9(2)10(8)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 1,2,3-trimethylcycloheptane?
1,2,3-trimethylcycloheptane has a molecular weight of 140.27 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylcycloheptane is sourced from PubChem (CID 54005509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).