C9H20I2 — CID 159309824
1,2-dimethylcyclohexane;methane;molecular iodine (PubChem CID 159309824) has the molecular formula C9H20I2 and a molecular weight of 382.07 g/mol. Its IUPAC name is 1,2-dimethylcyclohexane;methane;molecular iodine.
| Compound Name | 1,2-dimethylcyclohexane;methane;molecular iodine |
|---|---|
| PubChem CID | 159309824 |
| Molecular Formula | C9H20I2 |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 1,2-dimethylcyclohexane;methane;molecular iodine |
| SMILES | C.CC1CCCCC1C.II |
| InChI | InChI=1S/C8H16.CH4.I2/c1-7-5-3-4-6-8(7)2;;1-2/h7-8H,3-6H2,1-2H3;1H4; |
| InChIKey | LCJVWUNQHMRCOO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|