C7H14IN — CID 88940989
cis-(1S,2R)-N-iodo-2-methylcyclohexan-1-amine (PubChem CID 88940989) has the molecular formula C7H14IN and a molecular weight of 239.10 g/mol. Its IUPAC name is cis-(1S,2R)-N-iodo-2-methylcyclohexan-1-amine.
| Compound Name | cis-(1S,2R)-N-iodo-2-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 88940989 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | cis-(1S,2R)-N-iodo-2-methylcyclohexan-1-amine |
| SMILES | C[C@@H]1CCCC[C@@H]1NI |
| InChI | InChI=1S/C7H14IN/c1-6-4-2-3-5-7(6)9-8/h6-7,9H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | TWEWWSMXWVCVDR-RQJHMYQMSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|