C9H21N — CID 144598118
N,2-dimethylcyclopentan-1-amine;ethane (PubChem CID 144598118) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is N,2-dimethylcyclopentan-1-amine;ethane.
| Compound Name | N,2-dimethylcyclopentan-1-amine;ethane |
|---|---|
| PubChem CID | 144598118 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N,2-dimethylcyclopentan-1-amine;ethane |
| SMILES | CC.CNC1CCCC1C |
| InChI | InChI=1S/C7H15N.C2H6/c1-6-4-3-5-7(6)8-2;1-2/h6-8H,3-5H2,1-2H3;1-2H3 |
| InChIKey | AWCLFGQJBAWMPO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |