C10H22N2 — CID 85255471
1-N,2-N-dimethylcyclooctane-1,2-diamine (PubChem CID 85255471) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N,2-N-dimethylcyclooctane-1,2-diamine.
| Compound Name | 1-N,2-N-dimethylcyclooctane-1,2-diamine |
|---|---|
| PubChem CID | 85255471 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N,2-N-dimethylcyclooctane-1,2-diamine |
| SMILES | CNC1CCCCCCC1NC |
| InChI | InChI=1S/C10H22N2/c1-11-9-7-5-3-4-6-8-10(9)12-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | VQMFRXXOVNHLBL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |