C17H36N2 — CID 63466542
2-N,2-N-diethyl-1-N-methylcyclododecane-1,2-diamine (PubChem CID 63466542) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-N-methylcyclododecane-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-1-N-methylcyclododecane-1,2-diamine |
|---|---|
| PubChem CID | 63466542 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 2-N,2-N-diethyl-1-N-methylcyclododecane-1,2-diamine |
| SMILES | CCN(CC)C1CCCCCCCCCCC1NC |
| InChI | InChI=1S/C17H36N2/c1-4-19(5-2)17-15-13-11-9-7-6-8-10-12-14-16(17)18-3/h16-18H,4-15H2,1-3H3 |
| InChIKey | MZFMEMQQFLCMHS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |