C19H40N2 — CID 63466736
1-N-methyl-2-N,2-N-dipropylcyclododecane-1,2-diamine (PubChem CID 63466736) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-N-methyl-2-N,2-N-dipropylcyclododecane-1,2-diamine.
| Compound Name | 1-N-methyl-2-N,2-N-dipropylcyclododecane-1,2-diamine |
|---|---|
| PubChem CID | 63466736 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 1-N-methyl-2-N,2-N-dipropylcyclododecane-1,2-diamine |
| SMILES | CCCN(CCC)C1CCCCCCCCCCC1NC |
| InChI | InChI=1S/C19H40N2/c1-4-16-21(17-5-2)19-15-13-11-9-7-6-8-10-12-14-18(19)20-3/h18-20H,4-17H2,1-3H3 |
| InChIKey | CUKFGQYTFLZLFO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |