About trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine
trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine (PubChem CID 129406607) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine.
Analyze trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine?
The IUPAC name of trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine (CID 129406607) is trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine.
What is the SMILES notation for trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine?
The canonical SMILES for trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine is CN[C@@H]1CCC[C@H]1NC.
What is the InChIKey of trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine?
The InChIKey is BLAIRNNBMSDUQN-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H16N2/c1-8-6-4-3-5-7(6)9-2/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine?
trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine has a molecular weight of 128.22 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-N,2-N-dimethylcyclopentane-1,2-diamine is sourced from PubChem (CID 129406607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).