About trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine
trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine (PubChem CID 71351363) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine.
Analyze trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine?
The IUPAC name of trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine (CID 71351363) is trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine.
What is the SMILES notation for trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine?
The canonical SMILES for trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine is CCN[C@@H]1CCC[C@H]1C.
What is the InChIKey of trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine?
The InChIKey is DAPDKDGIWOJLKQ-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17N/c1-3-9-8-6-4-5-7(8)2/h7-9H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine?
trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine has a molecular weight of 127.23 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N-ethyl-2-methylcyclopentan-1-amine is sourced from PubChem (CID 71351363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).