C7H16N2 — CID 134287800
(2S)-1-N-ethylcyclopentane-1,2-diamine (PubChem CID 134287800) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (2S)-1-N-ethylcyclopentane-1,2-diamine.
| Compound Name | (2S)-1-N-ethylcyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 134287800 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (2S)-1-N-ethylcyclopentane-1,2-diamine |
| SMILES | CCNC1CCC[C@@H]1N |
| InChI | InChI=1S/C7H16N2/c1-2-9-7-5-3-4-6(7)8/h6-7,9H,2-5,8H2,1H3/t6-,7?/m0/s1 |
| InChIKey | DNUCHOPBDSEFEO-PKPIPKONSA-N |
| XLogP | 0.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |