C18H38N2 — CID 158355577
trans-(1R,2R)-2-N-dodecylcyclohexane-1,2-diamine (PubChem CID 158355577) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-dodecylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-dodecylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 158355577 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | trans-(1R,2R)-2-N-dodecylcyclohexane-1,2-diamine |
| SMILES | CCCCCCCCCCCCN[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C18H38N2/c1-2-3-4-5-6-7-8-9-10-13-16-20-18-15-12-11-14-17(18)19/h17-18,20H,2-16,19H2,1H3/t17-,18-/m1/s1 |
| InChIKey | GSVHTYBZRGIBSA-QZTJIDSGSA-N |
| XLogP | 4.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|