C12H28Cl2N2 — CID 139240198
trans-(1R,2R)-2-N-hexylcyclohexane-1,2-diamine;dihydrochloride (PubChem CID 139240198) has the molecular formula C12H28Cl2N2 and a molecular weight of 271.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-hexylcyclohexane-1,2-diamine;dihydrochloride.
| Compound Name | trans-(1R,2R)-2-N-hexylcyclohexane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 139240198 |
| Molecular Formula | C12H28Cl2N2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | trans-(1R,2R)-2-N-hexylcyclohexane-1,2-diamine;dihydrochloride |
| SMILES | CCCCCCN[C@@H]1CCCC[C@H]1N.Cl.Cl |
| InChI | InChI=1S/C12H26N2.2ClH/c1-2-3-4-7-10-14-12-9-6-5-8-11(12)13;;/h11-12,14H,2-10,13H2,1H3;2*1H/t11-,12-;;/m1../s1 |
| InChIKey | YNEVVWUNTYZYBE-MBORUXJMSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|