C11H22FN — CID 126847778
trans-(1R,2R)-2-fluoro-N-pentylcyclohexan-1-amine (PubChem CID 126847778) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is trans-(1R,2R)-2-fluoro-N-pentylcyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-fluoro-N-pentylcyclohexan-1-amine |
|---|---|
| PubChem CID | 126847778 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | trans-(1R,2R)-2-fluoro-N-pentylcyclohexan-1-amine |
| SMILES | CCCCCN[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C11H22FN/c1-2-3-6-9-13-11-8-5-4-7-10(11)12/h10-11,13H,2-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | MWHRRSKSZZSXQS-GHMZBOCLSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|