C7H14FN — CID 126847838
trans-(1R,2R)-N-ethyl-2-fluorocyclopentan-1-amine (PubChem CID 126847838) has the molecular formula C7H14FN and a molecular weight of 131.19 g/mol. Its IUPAC name is trans-(1R,2R)-N-ethyl-2-fluorocyclopentan-1-amine.
| Compound Name | trans-(1R,2R)-N-ethyl-2-fluorocyclopentan-1-amine |
|---|---|
| PubChem CID | 126847838 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | trans-(1R,2R)-N-ethyl-2-fluorocyclopentan-1-amine |
| SMILES | CCN[C@@H]1CCC[C@H]1F |
| InChI | InChI=1S/C7H14FN/c1-2-9-7-5-3-4-6(7)8/h6-7,9H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | MRBBXSLLIOJWTQ-RNFRBKRXSA-N |
| XLogP | 1.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |