About 1,2-difluorocyclopentane;propane
1,2-difluorocyclopentane;propane (PubChem CID 171503216) has the molecular formula C8H16F2
and a molecular weight of 150.21 g/mol. Its IUPAC name is 1,2-difluorocyclopentane;propane.
Molecular Properties
| Compound Name | 1,2-difluorocyclopentane;propane |
| PubChem CID | 171503216 |
| Molecular Formula | C8H16F2 |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1,2-difluorocyclopentane;propane |
| SMILES | CCC.FC1CCCC1F |
| InChI | InChI=1S/C5H8F2.C3H8/c6-4-2-1-3-5(4)7;1-3-2/h4-5H,1-3H2;3H2,1-2H3 |
| InChIKey | QPWRBVAJRKZICG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-difluorocyclopentane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluorocyclopentane;propane?
The IUPAC name of 1,2-difluorocyclopentane;propane (CID 171503216) is 1,2-difluorocyclopentane;propane.
What is the SMILES notation for 1,2-difluorocyclopentane;propane?
The canonical SMILES for 1,2-difluorocyclopentane;propane is CCC.FC1CCCC1F.
What is the InChIKey of 1,2-difluorocyclopentane;propane?
The InChIKey is QPWRBVAJRKZICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2.C3H8/c6-4-2-1-3-5(4)7;1-3-2/h4-5H,1-3H2;3H2,1-2H3.
What are the key properties of 1,2-difluorocyclopentane;propane?
1,2-difluorocyclopentane;propane has a molecular weight of 150.21 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluorocyclopentane;propane is sourced from PubChem (CID 171503216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).