About (1R)-1,3-difluoro-2-methylcyclohexane
(1R)-1,3-difluoro-2-methylcyclohexane (PubChem CID 134531645) has the molecular formula C7H12F2
and a molecular weight of 134.17 g/mol. Its IUPAC name is (1R)-1,3-difluoro-2-methylcyclohexane.
Molecular Properties
| Compound Name | (1R)-1,3-difluoro-2-methylcyclohexane |
| PubChem CID | 134531645 |
| Molecular Formula | C7H12F2 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (1R)-1,3-difluoro-2-methylcyclohexane |
| SMILES | CC1C(F)CCC[C@H]1F |
| InChI | InChI=1S/C7H12F2/c1-5-6(8)3-2-4-7(5)9/h5-7H,2-4H2,1H3/t5?,6-,7?/m1/s1 |
| InChIKey | STKMGTFXDMLEJE-YURFNIAASA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R)-1,3-difluoro-2-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,3-difluoro-2-methylcyclohexane?
The IUPAC name of (1R)-1,3-difluoro-2-methylcyclohexane (CID 134531645) is (1R)-1,3-difluoro-2-methylcyclohexane.
What is the SMILES notation for (1R)-1,3-difluoro-2-methylcyclohexane?
The canonical SMILES for (1R)-1,3-difluoro-2-methylcyclohexane is CC1C(F)CCC[C@H]1F.
What is the InChIKey of (1R)-1,3-difluoro-2-methylcyclohexane?
The InChIKey is STKMGTFXDMLEJE-YURFNIAASA-N. The full InChI is InChI=1S/C7H12F2/c1-5-6(8)3-2-4-7(5)9/h5-7H,2-4H2,1H3/t5?,6-,7?/m1/s1.
What are the key properties of (1R)-1,3-difluoro-2-methylcyclohexane?
(1R)-1,3-difluoro-2-methylcyclohexane has a molecular weight of 134.17 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,3-difluoro-2-methylcyclohexane is sourced from PubChem (CID 134531645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).