C8H14F2 — CID 134441969
trans-(3S,4S)-1,3-difluoro-2,4-dimethylcyclohexane (PubChem CID 134441969) has the molecular formula C8H14F2 and a molecular weight of 148.20 g/mol. Its IUPAC name is trans-(3S,4S)-1,3-difluoro-2,4-dimethylcyclohexane.
| Compound Name | trans-(3S,4S)-1,3-difluoro-2,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 134441969 |
| Molecular Formula | C8H14F2 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | trans-(3S,4S)-1,3-difluoro-2,4-dimethylcyclohexane |
| SMILES | CC1C(F)CC[C@H](C)[C@@H]1F |
| InChI | InChI=1S/C8H14F2/c1-5-3-4-7(9)6(2)8(5)10/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8-/m0/s1 |
| InChIKey | HLFJUPBWQJVQGJ-UMULYZNJSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |