C7H12F2O — CID 89103699
2,3-difluoro-4-methylcyclohexan-1-ol (PubChem CID 89103699) has the molecular formula C7H12F2O and a molecular weight of 150.17 g/mol. Its IUPAC name is 2,3-difluoro-4-methylcyclohexan-1-ol.
| Compound Name | 2,3-difluoro-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 89103699 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2,3-difluoro-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)C(F)C1F |
| InChI | InChI=1S/C7H12F2O/c1-4-2-3-5(10)7(9)6(4)8/h4-7,10H,2-3H2,1H3 |
| InChIKey | WULVCDISBOXZIL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |