C24H44F2O — CID 144922818
2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexan-1-ol;ethane;prop-1-ene (PubChem CID 144922818) has the molecular formula C24H44F2O and a molecular weight of 386.61 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexan-1-ol;ethane;prop-1-ene.
| Compound Name | 2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexan-1-ol;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144922818 |
| Molecular Formula | C24H44F2O |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 2,3-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexan-1-ol;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC1CCC(C2CCC(C3CCC(O)C(F)C3F)CC2)CC1 |
| InChI | InChI=1S/C19H32F2O.C3H6.C2H6/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)16-10-11-17(22)19(21)18(16)20;1-3-2;1-2/h12-19,22H,2-11H2,1H3;3H,1H2,2H3;1-2H3 |
| InChIKey | LPMWCAVBLZFNHI-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|