C16H26F2O — CID 138663744
4-(4-cyclobutylcyclohexyl)-2,3-difluorocyclohexan-1-ol (PubChem CID 138663744) has the molecular formula C16H26F2O and a molecular weight of 272.38 g/mol. Its IUPAC name is 4-(4-cyclobutylcyclohexyl)-2,3-difluorocyclohexan-1-ol.
| Compound Name | 4-(4-cyclobutylcyclohexyl)-2,3-difluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 138663744 |
| Molecular Formula | C16H26F2O |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-(4-cyclobutylcyclohexyl)-2,3-difluorocyclohexan-1-ol |
| SMILES | OC1CCC(C2CCC(C3CCC3)CC2)C(F)C1F |
| InChI | InChI=1S/C16H26F2O/c17-15-13(8-9-14(19)16(15)18)12-6-4-11(5-7-12)10-2-1-3-10/h10-16,19H,1-9H2 |
| InChIKey | XPXVCMCTUWEBHV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |