C19H32F2OS — CID 138567306
2,3-difluoro-4-[4-[(4-sulfanylcyclohexyl)methyl]cyclohexyl]cyclohexan-1-ol (PubChem CID 138567306) has the molecular formula C19H32F2OS and a molecular weight of 346.53 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[(4-sulfanylcyclohexyl)methyl]cyclohexyl]cyclohexan-1-ol.
| Compound Name | 2,3-difluoro-4-[4-[(4-sulfanylcyclohexyl)methyl]cyclohexyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 138567306 |
| Molecular Formula | C19H32F2OS |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2,3-difluoro-4-[4-[(4-sulfanylcyclohexyl)methyl]cyclohexyl]cyclohexan-1-ol |
| SMILES | OC1CCC(C2CCC(CC3CCC(S)CC3)CC2)C(F)C1F |
| InChI | InChI=1S/C19H32F2OS/c20-18-16(9-10-17(22)19(18)21)14-5-1-12(2-6-14)11-13-3-7-15(23)8-4-13/h12-19,22-23H,1-11H2 |
| InChIKey | XAYVGTVIMKYZPI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|