C26H41F4I — CID 90437570
(1S,3S,4R)-1-cyclohexyl-4-[4-[2-[(2R)-2,3-difluoro-4-iodocyclohexyl]ethyl]cyclohexyl]-2,3-difluorocyclohexane (PubChem CID 90437570) has the molecular formula C26H41F4I and a molecular weight of 556.51 g/mol. Its IUPAC name is (1S,3S,4R)-1-cyclohexyl-4-[4-[2-[(2R)-2,3-difluoro-4-iodocyclohexyl]ethyl]cyclohexyl]-2,3-difluorocyclohexane.
| Compound Name | (1S,3S,4R)-1-cyclohexyl-4-[4-[2-[(2R)-2,3-difluoro-4-iodocyclohexyl]ethyl]cyclohexyl]-2,3-difluorocyclohexane |
|---|---|
| PubChem CID | 90437570 |
| Molecular Formula | C26H41F4I |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (1S,3S,4R)-1-cyclohexyl-4-[4-[2-[(2R)-2,3-difluoro-4-iodocyclohexyl]ethyl]cyclohexyl]-2,3-difluorocyclohexane |
| SMILES | FC1C(I)CCC(CCC2CCC([C@H]3CC[C@@H](C4CCCCC4)C(F)[C@H]3F)CC2)[C@H]1F |
| InChI | InChI=1S/C26H41F4I/c27-23-19(12-15-22(31)26(23)30)11-8-16-6-9-18(10-7-16)21-14-13-20(24(28)25(21)29)17-4-2-1-3-5-17/h16-26H,1-15H2/t16?,18?,19?,20-,21+,22?,23+,24?,25-,26?/m0/s1 |
| InChIKey | XGIBUMSERDCEBH-JRGOKATOSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|