C25H40F3IO — CID 90437164
(3S)-1-cyclohexyl-2,3-difluoro-4-[[4-(3-fluoro-4-iodocyclohexyl)cyclohexyl]methoxy]cyclohexane (PubChem CID 90437164) has the molecular formula C25H40F3IO and a molecular weight of 540.49 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-2,3-difluoro-4-[[4-(3-fluoro-4-iodocyclohexyl)cyclohexyl]methoxy]cyclohexane.
| Compound Name | (3S)-1-cyclohexyl-2,3-difluoro-4-[[4-(3-fluoro-4-iodocyclohexyl)cyclohexyl]methoxy]cyclohexane |
|---|---|
| PubChem CID | 90437164 |
| Molecular Formula | C25H40F3IO |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (3S)-1-cyclohexyl-2,3-difluoro-4-[[4-(3-fluoro-4-iodocyclohexyl)cyclohexyl]methoxy]cyclohexane |
| SMILES | FC1CC(C2CCC(COC3CCC(C4CCCCC4)C(F)[C@H]3F)CC2)CCC1I |
| InChI | InChI=1S/C25H40F3IO/c26-21-14-19(10-12-22(21)29)17-8-6-16(7-9-17)15-30-23-13-11-20(24(27)25(23)28)18-4-2-1-3-5-18/h16-25H,1-15H2/t16?,17?,19?,20?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | RNSFXXBVTKNXDE-NDHHOQSMSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|