C26H42F3I — CID 90437153
(4S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-[(1R,4S)-3-fluoro-4-iodocyclohexyl]cyclohexyl]ethyl]cyclohexane (PubChem CID 90437153) has the molecular formula C26H42F3I and a molecular weight of 538.52 g/mol. Its IUPAC name is (4S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-[(1R,4S)-3-fluoro-4-iodocyclohexyl]cyclohexyl]ethyl]cyclohexane.
| Compound Name | (4S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-[(1R,4S)-3-fluoro-4-iodocyclohexyl]cyclohexyl]ethyl]cyclohexane |
|---|---|
| PubChem CID | 90437153 |
| Molecular Formula | C26H42F3I |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (4S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-[(1R,4S)-3-fluoro-4-iodocyclohexyl]cyclohexyl]ethyl]cyclohexane |
| SMILES | FC1C(C2CCCCC2)CC[C@H](CCC2CCC([C@@H]3CC[C@H](I)C(F)C3)CC2)C1F |
| InChI | InChI=1S/C26H42F3I/c27-23-16-21(13-15-24(23)30)18-9-6-17(7-10-18)8-11-20-12-14-22(26(29)25(20)28)19-4-2-1-3-5-19/h17-26H,1-16H2/t17?,18?,20-,21+,22?,23?,24-,25?,26?/m0/s1 |
| InChIKey | KXOSAAJUVXGDMZ-AICJIMKZSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|