C31H53F3 — CID 90437163
(3S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-(2-fluoro-4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexane (PubChem CID 90437163) has the molecular formula C31H53F3 and a molecular weight of 482.76 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-(2-fluoro-4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexane.
| Compound Name | (3S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-(2-fluoro-4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexane |
|---|---|
| PubChem CID | 90437163 |
| Molecular Formula | C31H53F3 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | (3S)-1-cyclohexyl-2,3-difluoro-4-[2-[4-(2-fluoro-4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexane |
| SMILES | CCCCCC1CCC(C2CCC(CCC3CCC(C4CCCCC4)C(F)[C@H]3F)CC2)C(F)C1 |
| InChI | InChI=1S/C31H53F3/c1-2-3-5-8-23-14-19-27(29(32)21-23)25-15-11-22(12-16-25)13-17-26-18-20-28(31(34)30(26)33)24-9-6-4-7-10-24/h22-31H,2-21H2,1H3/t22?,23?,25?,26?,27?,28?,29?,30-,31?/m0/s1 |
| InChIKey | BTEGAZNEUIDVME-YWPWWZGSSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|