C32H54F4 — CID 90437368
(2S)-1-[4-[2-(2,3-difluoro-4-methylcyclohexyl)ethyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 90437368) has the molecular formula C32H54F4 and a molecular weight of 514.78 g/mol. Its IUPAC name is (2S)-1-[4-[2-(2,3-difluoro-4-methylcyclohexyl)ethyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)cyclohexane.
| Compound Name | (2S)-1-[4-[2-(2,3-difluoro-4-methylcyclohexyl)ethyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 90437368 |
| Molecular Formula | C32H54F4 |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | (2S)-1-[4-[2-(2,3-difluoro-4-methylcyclohexyl)ethyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(CCC4CCC(C)C(F)C4F)CC3)[C@H](F)C2F)CC1 |
| InChI | InChI=1S/C32H54F4/c1-3-4-5-6-22-8-14-24(15-9-22)27-19-20-28(32(36)31(27)35)25-16-10-23(11-17-25)12-18-26-13-7-21(2)29(33)30(26)34/h21-32H,3-20H2,1-2H3/t21?,22?,23?,24?,25?,26?,27?,28?,29?,30?,31?,32-/m0/s1 |
| InChIKey | WSUXATYIOYPWNE-OUBPAXONSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|