About 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate
2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate (PubChem CID 161225778) has the molecular formula C16H32F2O
and a molecular weight of 278.43 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate.
Molecular Properties
| Compound Name | 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate |
| PubChem CID | 161225778 |
| Molecular Formula | C16H32F2O |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate |
| SMILES | CC1CCC(CCC2CCC(C)C(F)C2F)CC1.O.[H][H] |
| InChI | InChI=1S/C16H28F2.H2O.H2/c1-11-3-6-13(7-4-11)8-10-14-9-5-12(2)15(17)16(14)18;;/h11-16H,3-10H2,1-2H3;1H2;1H |
| InChIKey | PYQSQYSOXAXZEO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate?
The IUPAC name of 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate (CID 161225778) is 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate.
What is the SMILES notation for 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate?
The canonical SMILES for 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate is CC1CCC(CCC2CCC(C)C(F)C2F)CC1.O.[H][H].
What is the InChIKey of 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate?
The InChIKey is PYQSQYSOXAXZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28F2.H2O.H2/c1-11-3-6-13(7-4-11)8-10-14-9-5-12(2)15(17)16(14)18;;/h11-16H,3-10H2,1-2H3;1H2;1H.
What are the key properties of 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate?
2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate has a molecular weight of 278.43 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-1-methyl-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane;molecular hydrogen;hydrate is sourced from PubChem (CID 161225778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).