C19H35FO — CID 140706991
1-(4-ethoxycyclohexyl)-2-fluoro-4-pentylcyclohexane (PubChem CID 140706991) has the molecular formula C19H35FO and a molecular weight of 298.49 g/mol. Its IUPAC name is 1-(4-ethoxycyclohexyl)-2-fluoro-4-pentylcyclohexane.
| Compound Name | 1-(4-ethoxycyclohexyl)-2-fluoro-4-pentylcyclohexane |
|---|---|
| PubChem CID | 140706991 |
| Molecular Formula | C19H35FO |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-(4-ethoxycyclohexyl)-2-fluoro-4-pentylcyclohexane |
| SMILES | CCCCCC1CCC(C2CCC(OCC)CC2)C(F)C1 |
| InChI | InChI=1S/C19H35FO/c1-3-5-6-7-15-8-13-18(19(20)14-15)16-9-11-17(12-10-16)21-4-2/h15-19H,3-14H2,1-2H3 |
| InChIKey | LAPUQLHVUIONFP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|