C23H42O — CID 56998693
(2R,7R)-2-butyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 56998693) has the molecular formula C23H42O and a molecular weight of 334.59 g/mol. Its IUPAC name is (2R,7R)-2-butyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | (2R,7R)-2-butyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 56998693 |
| Molecular Formula | C23H42O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.32 |
| IUPAC Name | (2R,7R)-2-butyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCCCCO[C@@H]1CCC2C(CCC3C[C@H](CCCC)CCC32)C1 |
| InChI | InChI=1S/C23H42O/c1-3-5-7-15-24-21-12-14-23-20(17-21)11-10-19-16-18(8-6-4-2)9-13-22(19)23/h18-23H,3-17H2,1-2H3/t18-,19?,20?,21-,22?,23?/m1/s1 |
| InChIKey | CISXEBLLGGPBAZ-LSVJMJEJSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|