C30H54O2 — CID 70506564
[(2S,7S)-7-octyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-2-yl] octanoate (PubChem CID 70506564) has the molecular formula C30H54O2 and a molecular weight of 446.76 g/mol. Its IUPAC name is [(2S,7S)-7-octyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-2-yl] octanoate.
| Compound Name | [(2S,7S)-7-octyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-2-yl] octanoate |
|---|---|
| PubChem CID | 70506564 |
| Molecular Formula | C30H54O2 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.41 |
| IUPAC Name | [(2S,7S)-7-octyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-2-yl] octanoate |
| SMILES | CCCCCCCC[C@H]1CCC2C(CCC3C[C@@H](OC(=O)CCCCCCC)CCC32)C1 |
| InChI | InChI=1S/C30H54O2/c1-3-5-7-9-11-12-14-24-16-20-28-25(22-24)17-18-26-23-27(19-21-29(26)28)32-30(31)15-13-10-8-6-4-2/h24-29H,3-23H2,1-2H3/t24-,25?,26?,27-,28?,29?/m0/s1 |
| InChIKey | DHZTUVVABZDRJF-PYLXETOHSA-N |
| XLogP | 9.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|