C23H41Cl — CID 70505784
(2S,7S)-2-chloro-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 70505784) has the molecular formula C23H41Cl and a molecular weight of 353.03 g/mol. Its IUPAC name is (2S,7S)-2-chloro-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | (2S,7S)-2-chloro-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 70505784 |
| Molecular Formula | C23H41Cl |
| Molecular Weight | 353.03 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | (2S,7S)-2-chloro-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCCCCCCCC[C@H]1CCC2C(CCC3C[C@@H](Cl)CCC32)C1 |
| InChI | InChI=1S/C23H41Cl/c1-2-3-4-5-6-7-8-9-18-10-14-22-19(16-18)11-12-20-17-21(24)13-15-23(20)22/h18-23H,2-17H2,1H3/t18-,19?,20?,21-,22?,23?/m0/s1 |
| InChIKey | KHSAOAYHUXDJDT-UCNHFWRGSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.03 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|