C24H41N — CID 57268895
(2R,7R)-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile (PubChem CID 57268895) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is (2R,7R)-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile.
| Compound Name | (2R,7R)-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 57268895 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | (2R,7R)-7-nonyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile |
| SMILES | CCCCCCCCC[C@@H]1CCC2C(CCC3C[C@H](C#N)CCC32)C1 |
| InChI | InChI=1S/C24H41N/c1-2-3-4-5-6-7-8-9-19-10-14-23-21(16-19)12-13-22-17-20(18-25)11-15-24(22)23/h19-24H,2-17H2,1H3/t19-,20-,21?,22?,23?,24?/m1/s1 |
| InChIKey | OIJUQYDHCZQOEG-WLNXJYAXSA-N |
| XLogP | 7.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|