C28H49N — CID 56608789
(2S,7R)-7-heptyl-2-hexyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile (PubChem CID 56608789) has the molecular formula C28H49N and a molecular weight of 399.71 g/mol. Its IUPAC name is (2S,7R)-7-heptyl-2-hexyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile.
| Compound Name | (2S,7R)-7-heptyl-2-hexyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 56608789 |
| Molecular Formula | C28H49N |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | (2S,7R)-7-heptyl-2-hexyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
| SMILES | CCCCCCC[C@@H]1CCC2C(CCC3C[C@](C#N)(CCCCCC)CCC32)C1 |
| InChI | InChI=1S/C28H49N/c1-3-5-7-9-10-12-23-13-16-26-24(20-23)14-15-25-21-28(22-29,19-17-27(25)26)18-11-8-6-4-2/h23-27H,3-21H2,1-2H3/t23-,24?,25?,26?,27?,28+/m1/s1 |
| InChIKey | LHDBNTVKTVAAGJ-ZOUFNJHNSA-N |
| XLogP | 9.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|