C21H35NO — CID 56625350
(2S,7R)-7-methoxy-2-pentyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile (PubChem CID 56625350) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (2S,7R)-7-methoxy-2-pentyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile.
| Compound Name | (2S,7R)-7-methoxy-2-pentyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 56625350 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (2S,7R)-7-methoxy-2-pentyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
| SMILES | CCCCC[C@]1(C#N)CCC2C(CCC3C[C@H](OC)CCC32)C1 |
| InChI | InChI=1S/C21H35NO/c1-3-4-5-11-21(15-22)12-10-20-17(14-21)7-6-16-13-18(23-2)8-9-19(16)20/h16-20H,3-14H2,1-2H3/t16?,17?,18-,19?,20?,21+/m1/s1 |
| InChIKey | ADHQMGYPTWXPEN-KLEOGNQASA-N |
| XLogP | 5.72 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|