C26H43N — CID 70429669
(2S,7S)-7-ethyl-2-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile (PubChem CID 70429669) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (2S,7S)-7-ethyl-2-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile.
| Compound Name | (2S,7S)-7-ethyl-2-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
|---|---|
| PubChem CID | 70429669 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (2S,7S)-7-ethyl-2-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
| SMILES | CCCCC[C@]1(C#N)CCC2C(CCC3C2CCC2C3CCC[C@@H]2CC)C1 |
| InChI | InChI=1S/C26H43N/c1-3-5-6-15-26(18-27)16-14-22-20(17-26)10-11-25-23-9-7-8-19(4-2)21(23)12-13-24(22)25/h19-25H,3-17H2,1-2H3/t19-,20?,21?,22?,23?,24?,25?,26-/m0/s1 |
| InChIKey | ZYUZUQLGTDPDLV-CNBDEGRTSA-N |
| XLogP | 7.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|