C21H37N — CID 18603412
(2S,4aR,6S)-2,6-dipentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile (PubChem CID 18603412) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is (2S,4aR,6S)-2,6-dipentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2S,4aR,6S)-2,6-dipentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 18603412 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | (2S,4aR,6S)-2,6-dipentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
| SMILES | CCCCC[C@H]1CCC2C[C@](C#N)(CCCCC)CC[C@@H]2C1 |
| InChI | InChI=1S/C21H37N/c1-3-5-7-9-18-10-11-20-16-21(17-22,13-8-6-4-2)14-12-19(20)15-18/h18-20H,3-16H2,1-2H3/t18-,19+,20?,21-/m0/s1 |
| InChIKey | JIPULWQGFTUEIZ-JKWVGCSGSA-N |
| XLogP | 6.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|