C27H47N — CID 18603447
(2S,4aR,6S,8aR)-6-(4-butylcyclohexyl)-2-hexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile (PubChem CID 18603447) has the molecular formula C27H47N and a molecular weight of 385.68 g/mol. Its IUPAC name is (2S,4aR,6S,8aR)-6-(4-butylcyclohexyl)-2-hexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2S,4aR,6S,8aR)-6-(4-butylcyclohexyl)-2-hexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 18603447 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | (2S,4aR,6S,8aR)-6-(4-butylcyclohexyl)-2-hexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
| SMILES | CCCCCC[C@]1(C#N)CC[C@@H]2C[C@@H](C3CCC(CCCC)CC3)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H47N/c1-3-5-7-8-17-27(21-28)18-16-25-19-24(14-15-26(25)20-27)23-12-10-22(11-13-23)9-6-4-2/h22-26H,3-20H2,1-2H3/t22?,23?,24-,25+,26+,27-/m0/s1 |
| InChIKey | QMKMPLRUTIWBRK-YBKFAXIASA-N |
| XLogP | 8.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|