C23H41N — CID 18603436
(2S,4aR,6S)-2-heptyl-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile (PubChem CID 18603436) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is (2S,4aR,6S)-2-heptyl-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2S,4aR,6S)-2-heptyl-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 18603436 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | (2S,4aR,6S)-2-heptyl-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
| SMILES | CCCCCCC[C@]1(C#N)CC[C@@H]2C[C@@H](CCCCC)CCC2C1 |
| InChI | InChI=1S/C23H41N/c1-3-5-7-8-10-15-23(19-24)16-14-21-17-20(11-9-6-4-2)12-13-22(21)18-23/h20-22H,3-18H2,1-2H3/t20-,21+,22?,23-/m0/s1 |
| InChIKey | IZAWQFIVGCPBJR-KORDQABASA-N |
| XLogP | 7.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|