C22H39N — CID 18603434
(2S,4aR,6S)-6-butyl-2-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile (PubChem CID 18603434) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is (2S,4aR,6S)-6-butyl-2-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2S,4aR,6S)-6-butyl-2-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 18603434 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | (2S,4aR,6S)-6-butyl-2-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
| SMILES | CCCCCCC[C@]1(C#N)CC[C@@H]2C[C@@H](CCCC)CCC2C1 |
| InChI | InChI=1S/C22H39N/c1-3-5-7-8-9-14-22(18-23)15-13-20-16-19(10-6-4-2)11-12-21(20)17-22/h19-21H,3-17H2,1-2H3/t19-,20+,21?,22-/m0/s1 |
| InChIKey | BEHQKIYGBYLEDA-PJEZACDQSA-N |
| XLogP | 7.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|