C23H39N — CID 70430028
(2R,7S)-2-pentyl-7-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile (PubChem CID 70430028) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is (2R,7S)-2-pentyl-7-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile.
| Compound Name | (2R,7S)-2-pentyl-7-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 70430028 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | (2R,7S)-2-pentyl-7-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthrene-2-carbonitrile |
| SMILES | CCCCC[C@@]1(C#N)CCC2C(CCC3C[C@@H](CCC)CCC32)C1 |
| InChI | InChI=1S/C23H39N/c1-3-5-6-13-23(17-24)14-12-22-20(16-23)10-9-19-15-18(7-4-2)8-11-21(19)22/h18-22H,3-16H2,1-2H3/t18-,19?,20?,21?,22?,23+/m0/s1 |
| InChIKey | KGKSDJMVCCHZOP-YAFQNKTLSA-N |
| XLogP | 7.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|